C36H32N4S5 — CID 122449623
2-[[5-[10-[5-(2,2-dicyanoethenyl)-3-hexylthiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-hexylthiophen-2-yl]methylidene]propanedinitrile (PubChem CID 122449623) has the molecular formula C36H32N4S5 and a molecular weight of 681.02 g/mol. Its IUPAC name is 2-[[5-[10-[5-(2,2-dicyanoethenyl)-3-hexylthiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-hexylthiophen-2-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[5-[10-[5-(2,2-dicyanoethenyl)-3-hexylthiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-hexylthiophen-2-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 122449623 |
| Molecular Formula | C36H32N4S5 |
| Molecular Weight | 681.02 g/mol |
| Exact Mass | 680.12 |
| IUPAC Name | 2-[[5-[10-[5-(2,2-dicyanoethenyl)-3-hexylthiophen-2-yl]-3,7,11-trithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-4-hexylthiophen-2-yl]methylidene]propanedinitrile |
| SMILES | CCCCCCc1cc(C=C(C#N)C#N)sc1-c1cc2sc3cc(-c4sc(C=C(C#N)C#N)cc4CCCCCC)sc3c2s1 |
| InChI | InChI=1S/C36H32N4S5/c1-3-5-7-9-11-25-15-27(13-23(19-37)20-38)41-33(25)29-17-31-35(44-29)36-32(43-31)18-30(45-36)34-26(12-10-8-6-4-2)16-28(42-34)14-24(21-39)22-40/h13-18H,3-12H2,1-2H3 |
| InChIKey | POBBIDDGIMBWPY-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 95.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.02 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|