C36H36N4S4 — CID 169051814
(Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]-4-heptylthiophen-2-yl]thieno[3,2-b]thiophen-2-yl]-3-heptylthiophen-2-yl]-2-isocyanoprop-2-enenitrile (PubChem CID 169051814) has the molecular formula C36H36N4S4 and a molecular weight of 652.98 g/mol. Its IUPAC name is (Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]-4-heptylthiophen-2-yl]thieno[3,2-b]thiophen-2-yl]-3-heptylthiophen-2-yl]-2-isocyanoprop-2-enenitrile.
| Compound Name | (Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]-4-heptylthiophen-2-yl]thieno[3,2-b]thiophen-2-yl]-3-heptylthiophen-2-yl]-2-isocyanoprop-2-enenitrile |
|---|---|
| PubChem CID | 169051814 |
| Molecular Formula | C36H36N4S4 |
| Molecular Weight | 652.98 g/mol |
| Exact Mass | 652.18 |
| IUPAC Name | (Z)-3-[5-[5-[5-[(E)-2-cyano-2-isocyanoethenyl]-4-heptylthiophen-2-yl]thieno[3,2-b]thiophen-2-yl]-3-heptylthiophen-2-yl]-2-isocyanoprop-2-enenitrile |
| SMILES | [C-]#[N+]/C(C#N)=C\c1sc(-c2cc3sc(-c4cc(CCCCCCC)c(/C=C(\C#N)[N+]#[C-])s4)cc3s2)cc1CCCCCCC |
| InChI | InChI=1S/C36H36N4S4/c1-5-7-9-11-13-15-25-17-31(41-29(25)19-27(23-37)39-3)33-21-35-36(43-33)22-34(44-35)32-18-26(16-14-12-10-8-6-2)30(42-32)20-28(24-38)40-4/h17-22H,5-16H2,1-2H3/b27-19-,28-20+ |
| InChIKey | CMVUKVWUGHUDMR-RIRMOVKSSA-N |
| XLogP | 13.01 |
| TPSA | 56.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.98 |
| LogP ≤ 5 | 13.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|