C31H36O2S5 — CID 101025709
S-[5-[5-[5-(5-formyl-3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-4-hexylthiophen-2-yl] ethanethioate (PubChem CID 101025709) has the molecular formula C31H36O2S5 and a molecular weight of 600.96 g/mol. Its IUPAC name is S-[5-[5-[5-(5-formyl-3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-4-hexylthiophen-2-yl] ethanethioate.
| Compound Name | S-[5-[5-[5-(5-formyl-3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-4-hexylthiophen-2-yl] ethanethioate |
|---|---|
| PubChem CID | 101025709 |
| Molecular Formula | C31H36O2S5 |
| Molecular Weight | 600.96 g/mol |
| Exact Mass | 600.13 |
| IUPAC Name | S-[5-[5-[5-(5-formyl-3-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]-4-hexylthiophen-2-yl] ethanethioate |
| SMILES | CCCCCCc1cc(C=O)sc1-c1ccc(-c2ccc(-c3sc(SC(C)=O)cc3CCCCCC)s2)s1 |
| InChI | InChI=1S/C31H36O2S5/c1-4-6-8-10-12-22-18-24(20-32)35-30(22)27-16-14-25(36-27)26-15-17-28(37-26)31-23(13-11-9-7-5-2)19-29(38-31)34-21(3)33/h14-20H,4-13H2,1-3H3 |
| InChIKey | DBESREZYEKOQJF-UHFFFAOYSA-N |
| XLogP | 11.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.96 |
| LogP ≤ 5 | 11.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|