C42H48FeOS4+2 — CID 11285664
CID 11285664 (PubChem CID 11285664) has the molecular formula C42H48FeOS4+2 and a molecular weight of 752.96 g/mol.
| Compound Name | CID 11285664 |
|---|---|
| PubChem CID | 11285664 |
| Molecular Formula | C42H48FeOS4+2 |
| Molecular Weight | 752.96 g/mol |
| Exact Mass | 752.19 |
| IUPAC Name | — |
| SMILES | CCCCCCc1cc(C=O)sc1-c1ccc(-c2ccc(-c3sc(CCC[C]4[CH][CH][CH][CH]4)cc3CCCCCC)s2)s1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C37H43OS4.C5H5.Fe/c1-3-5-7-9-17-28-24-30(19-13-16-27-14-11-12-15-27)39-36(28)34-22-20-32(41-34)33-21-23-35(42-33)37-29(18-10-8-6-4-2)25-31(26-38)40-37;1-2-4-5-3-1;/h11-12,14-15,20-26H,3-10,13,16-19H2,1-2H3;1-5H;/q;;+2 |
| InChIKey | FOJYKADTYBIUBH-UHFFFAOYSA-N |
| XLogP | 13.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.96 |
| LogP ≤ 5 | 13.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|