C39H48S4 — CID 86058411
5-ethynyl-2-[5-[3-[5-(5-ethynyl-3-octylthiophen-2-yl)thiophen-2-yl]propyl]thiophen-2-yl]-3-octylthiophene (PubChem CID 86058411) has the molecular formula C39H48S4 and a molecular weight of 645.08 g/mol. Its IUPAC name is 5-ethynyl-2-[5-[3-[5-(5-ethynyl-3-octylthiophen-2-yl)thiophen-2-yl]propyl]thiophen-2-yl]-3-octylthiophene.
| Compound Name | 5-ethynyl-2-[5-[3-[5-(5-ethynyl-3-octylthiophen-2-yl)thiophen-2-yl]propyl]thiophen-2-yl]-3-octylthiophene |
|---|---|
| PubChem CID | 86058411 |
| Molecular Formula | C39H48S4 |
| Molecular Weight | 645.08 g/mol |
| Exact Mass | 644.26 |
| IUPAC Name | 5-ethynyl-2-[5-[3-[5-(5-ethynyl-3-octylthiophen-2-yl)thiophen-2-yl]propyl]thiophen-2-yl]-3-octylthiophene |
| SMILES | C#Cc1cc(CCCCCCCC)c(-c2ccc(CCCc3ccc(-c4sc(C#C)cc4CCCCCCCC)s3)s2)s1 |
| InChI | InChI=1S/C39H48S4/c1-5-9-11-13-15-17-20-30-28-32(7-3)42-38(30)36-26-24-34(40-36)22-19-23-35-25-27-37(41-35)39-31(29-33(8-4)43-39)21-18-16-14-12-10-6-2/h3-4,24-29H,5-6,9-23H2,1-2H3 |
| InChIKey | BGQSLWNQVGWLLR-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.08 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|