C30H44OS3 — CID 640124
2-[2,5-bis(5-octylthiophen-2-yl)thiophen-3-yl]ethanol (PubChem CID 640124) has the molecular formula C30H44OS3 and a molecular weight of 516.88 g/mol. Its IUPAC name is 2-[2,5-bis(5-octylthiophen-2-yl)thiophen-3-yl]ethanol.
| Compound Name | 2-[2,5-bis(5-octylthiophen-2-yl)thiophen-3-yl]ethanol |
|---|---|
| PubChem CID | 640124 |
| Molecular Formula | C30H44OS3 |
| Molecular Weight | 516.88 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | 2-[2,5-bis(5-octylthiophen-2-yl)thiophen-3-yl]ethanol |
| SMILES | CCCCCCCCc1ccc(-c2cc(CCO)c(-c3ccc(CCCCCCCC)s3)s2)s1 |
| InChI | InChI=1S/C30H44OS3/c1-3-5-7-9-11-13-15-25-17-19-27(32-25)29-23-24(21-22-31)30(34-29)28-20-18-26(33-28)16-14-12-10-8-6-4-2/h17-20,23,31H,3-16,21-22H2,1-2H3 |
| InChIKey | WWZHNJSULNCESV-UHFFFAOYSA-N |
| XLogP | 10.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.88 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|