C50H68N2OS5 — CID 102111969
(2S)-N-[2-[5-[4-hexyl-5-[4-hexyl-5-[4-hexyl-5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethyl]-2-isocyanopropanamide (PubChem CID 102111969) has the molecular formula C50H68N2OS5 and a molecular weight of 873.44 g/mol. Its IUPAC name is (2S)-N-[2-[5-[4-hexyl-5-[4-hexyl-5-[4-hexyl-5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethyl]-2-isocyanopropanamide.
| Compound Name | (2S)-N-[2-[5-[4-hexyl-5-[4-hexyl-5-[4-hexyl-5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethyl]-2-isocyanopropanamide |
|---|---|
| PubChem CID | 102111969 |
| Molecular Formula | C50H68N2OS5 |
| Molecular Weight | 873.44 g/mol |
| Exact Mass | 872.39 |
| IUPAC Name | (2S)-N-[2-[5-[4-hexyl-5-[4-hexyl-5-[4-hexyl-5-(5-hexylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]ethyl]-2-isocyanopropanamide |
| SMILES | [C-]#[N+][C@@H](C)C(=O)NCCc1ccc(-c2cc(CCCCCC)c(-c3cc(CCCCCC)c(-c4cc(CCCCCC)c(-c5ccc(CCCCCC)s5)s4)s3)s2)s1 |
| InChI | InChI=1S/C50H68N2OS5/c1-7-11-15-19-23-37-33-44(42-29-27-41(54-42)31-32-52-50(53)36(5)51-6)56-48(37)45-35-39(25-21-17-13-9-3)49(58-45)46-34-38(24-20-16-12-8-2)47(57-46)43-30-28-40(55-43)26-22-18-14-10-4/h27-30,33-36H,7-26,31-32H2,1-5H3,(H,52,53)/t36-/m0/s1 |
| InChIKey | CIMZFYVWERIBMX-BHVANESWSA-N |
| XLogP | 17.12 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 873.44 |
| LogP ≤ 5 | 17.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|