C31H32OS5 — CID 100938452
4-pentyl-5-[5-[5-[5-(3-pentylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 100938452) has the molecular formula C31H32OS5 and a molecular weight of 580.93 g/mol. Its IUPAC name is 4-pentyl-5-[5-[5-[5-(3-pentylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 4-pentyl-5-[5-[5-[5-(3-pentylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 100938452 |
| Molecular Formula | C31H32OS5 |
| Molecular Weight | 580.93 g/mol |
| Exact Mass | 580.11 |
| IUPAC Name | 4-pentyl-5-[5-[5-[5-(3-pentylthiophen-2-yl)thiophen-2-yl]thiophen-2-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCc1ccsc1-c1ccc(-c2ccc(-c3ccc(-c4sc(C=O)cc4CCCCC)s3)s2)s1 |
| InChI | InChI=1S/C31H32OS5/c1-3-5-7-9-21-17-18-33-30(21)28-15-13-26(36-28)24-11-12-25(35-24)27-14-16-29(37-27)31-22(10-8-6-4-2)19-23(20-32)34-31/h11-20H,3-10H2,1-2H3 |
| InChIKey | HCFLJIMTFKAATI-UHFFFAOYSA-N |
| XLogP | 11.94 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.93 |
| LogP ≤ 5 | 11.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|