C24H34O6P2S3 — CID 101498844
[4-hexyl-5-[5-(3-hexyl-5-phosphonothiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phosphonic acid (PubChem CID 101498844) has the molecular formula C24H34O6P2S3 and a molecular weight of 576.68 g/mol. Its IUPAC name is [4-hexyl-5-[5-(3-hexyl-5-phosphonothiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phosphonic acid.
| Compound Name | [4-hexyl-5-[5-(3-hexyl-5-phosphonothiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phosphonic acid |
|---|---|
| PubChem CID | 101498844 |
| Molecular Formula | C24H34O6P2S3 |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.10 |
| IUPAC Name | [4-hexyl-5-[5-(3-hexyl-5-phosphonothiophen-2-yl)thiophen-2-yl]thiophen-2-yl]phosphonic acid |
| SMILES | CCCCCCc1cc(P(=O)(O)O)sc1-c1ccc(-c2sc(P(=O)(O)O)cc2CCCCCC)s1 |
| InChI | InChI=1S/C24H34O6P2S3/c1-3-5-7-9-11-17-15-21(31(25,26)27)34-23(17)19-13-14-20(33-19)24-18(12-10-8-6-4-2)16-22(35-24)32(28,29)30/h13-16H,3-12H2,1-2H3,(H2,25,26,27)(H2,28,29,30) |
| InChIKey | UQQIEOBPDLOBSW-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|