C41H35N3O2S2 — CID 177469835
(Z)-2-cyano-3-[6-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-3-pyridinyl]prop-2-enoic acid (PubChem CID 177469835) has the molecular formula C41H35N3O2S2 and a molecular weight of 665.88 g/mol. Its IUPAC name is (Z)-2-cyano-3-[6-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-3-pyridinyl]prop-2-enoic acid.
| Compound Name | (Z)-2-cyano-3-[6-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-3-pyridinyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 177469835 |
| Molecular Formula | C41H35N3O2S2 |
| Molecular Weight | 665.88 g/mol |
| Exact Mass | 665.22 |
| IUPAC Name | (Z)-2-cyano-3-[6-[4-hexyl-5-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thiophen-2-yl]-3-pyridinyl]prop-2-enoic acid |
| SMILES | CCCCCCc1cc(-c2ccc(/C=C(/C#N)C(=O)O)cn2)sc1-c1ccc(-c2ccc(N(c3ccccc3)c3ccccc3)cc2)s1 |
| InChI | InChI=1S/C41H35N3O2S2/c1-2-3-4-7-12-31-26-39(36-22-17-29(28-43-36)25-32(27-42)41(45)46)48-40(31)38-24-23-37(47-38)30-18-20-35(21-19-30)44(33-13-8-5-9-14-33)34-15-10-6-11-16-34/h5-6,8-11,13-26,28H,2-4,7,12H2,1H3,(H,45,46)/b32-25- |
| InChIKey | OILQRBBPCKFZHJ-MKCFTUBBSA-N |
| XLogP | 11.79 |
| TPSA | 77.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.88 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|