C47H45N3OS5 — CID 71613487
5-[3-hexyl-5-[2-[4-hexyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]thiophene-2-carbaldehyde (PubChem CID 71613487) has the molecular formula C47H45N3OS5 and a molecular weight of 828.23 g/mol. Its IUPAC name is 5-[3-hexyl-5-[2-[4-hexyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[3-hexyl-5-[2-[4-hexyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 71613487 |
| Molecular Formula | C47H45N3OS5 |
| Molecular Weight | 828.23 g/mol |
| Exact Mass | 827.22 |
| IUPAC Name | 5-[3-hexyl-5-[2-[4-hexyl-5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]-[1,3]thiazolo[5,4-d][1,3]thiazol-5-yl]thiophen-2-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCCCc1cc(-c2nc3sc(-c4cc(CCCCCC)c(-c5ccc(C=O)s5)s4)nc3s2)sc1-c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C47H45N3OS5/c1-3-5-7-11-17-33-29-40(53-42(33)32-23-25-37(26-24-32)50(35-19-13-9-14-20-35)36-21-15-10-16-22-36)44-48-46-47(55-44)49-45(56-46)41-30-34(18-12-8-6-4-2)43(54-41)39-28-27-38(31-51)52-39/h9-10,13-16,19-31H,3-8,11-12,17-18H2,1-2H3 |
| InChIKey | LCROEVQZUAUMIS-UHFFFAOYSA-N |
| XLogP | 16.13 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.23 |
| LogP ≤ 5 | 16.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|