C22H20O2S — CID 141406317
4-[4-butyl-5-(4-formylphenyl)thiophen-2-yl]benzaldehyde (PubChem CID 141406317) has the molecular formula C22H20O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 4-[4-butyl-5-(4-formylphenyl)thiophen-2-yl]benzaldehyde.
| Compound Name | 4-[4-butyl-5-(4-formylphenyl)thiophen-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 141406317 |
| Molecular Formula | C22H20O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | 4-[4-butyl-5-(4-formylphenyl)thiophen-2-yl]benzaldehyde |
| SMILES | CCCCc1cc(-c2ccc(C=O)cc2)sc1-c1ccc(C=O)cc1 |
| InChI | InChI=1S/C22H20O2S/c1-2-3-4-20-13-21(18-9-5-16(14-23)6-10-18)25-22(20)19-11-7-17(15-24)8-12-19/h5-15H,2-4H2,1H3 |
| InChIKey | HVAFCBNDYQKJQY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|