C20H20O4S — CID 132550017
5-[5-(5-formylfuran-2-yl)-4-hexylthiophen-2-yl]furan-2-carbaldehyde (PubChem CID 132550017) has the molecular formula C20H20O4S and a molecular weight of 356.44 g/mol. Its IUPAC name is 5-[5-(5-formylfuran-2-yl)-4-hexylthiophen-2-yl]furan-2-carbaldehyde.
| Compound Name | 5-[5-(5-formylfuran-2-yl)-4-hexylthiophen-2-yl]furan-2-carbaldehyde |
|---|---|
| PubChem CID | 132550017 |
| Molecular Formula | C20H20O4S |
| Molecular Weight | 356.44 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 5-[5-(5-formylfuran-2-yl)-4-hexylthiophen-2-yl]furan-2-carbaldehyde |
| SMILES | CCCCCCc1cc(-c2ccc(C=O)o2)sc1-c1ccc(C=O)o1 |
| InChI | InChI=1S/C20H20O4S/c1-2-3-4-5-6-14-11-19(17-9-7-15(12-21)23-17)25-20(14)18-10-8-16(13-22)24-18/h7-13H,2-6H2,1H3 |
| InChIKey | NDFNZBLDESOCLI-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 60.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|