C17H22OS — CID 134965901
2,3-dibutyl-1-benzothiophene-6-carbaldehyde (PubChem CID 134965901) has the molecular formula C17H22OS and a molecular weight of 274.43 g/mol. Its IUPAC name is 2,3-dibutyl-1-benzothiophene-6-carbaldehyde.
| Compound Name | 2,3-dibutyl-1-benzothiophene-6-carbaldehyde |
|---|---|
| PubChem CID | 134965901 |
| Molecular Formula | C17H22OS |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 2,3-dibutyl-1-benzothiophene-6-carbaldehyde |
| SMILES | CCCCc1sc2cc(C=O)ccc2c1CCCC |
| InChI | InChI=1S/C17H22OS/c1-3-5-7-14-15-10-9-13(12-18)11-17(15)19-16(14)8-6-4-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | VIPPCBPGKWIBJK-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|