C41H36N2O3S3 — CID 139258102
5-[5-(2-ethylhexyl)-4,6-dioxo-3-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde (PubChem CID 139258102) has the molecular formula C41H36N2O3S3 and a molecular weight of 700.95 g/mol. Its IUPAC name is 5-[5-(2-ethylhexyl)-4,6-dioxo-3-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde.
| Compound Name | 5-[5-(2-ethylhexyl)-4,6-dioxo-3-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde |
|---|---|
| PubChem CID | 139258102 |
| Molecular Formula | C41H36N2O3S3 |
| Molecular Weight | 700.95 g/mol |
| Exact Mass | 700.19 |
| IUPAC Name | 5-[5-(2-ethylhexyl)-4,6-dioxo-3-[5-[4-(N-phenylanilino)phenyl]thiophen-2-yl]thieno[3,4-c]pyrrol-1-yl]thiophene-2-carbaldehyde |
| SMILES | CCCCC(CC)CN1C(=O)c2c(-c3ccc(C=O)s3)sc(-c3ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)s3)c2C1=O |
| InChI | InChI=1S/C41H36N2O3S3/c1-3-5-12-27(4-2)25-42-40(45)36-37(41(42)46)39(49-38(36)34-22-21-32(26-44)47-34)35-24-23-33(48-35)28-17-19-31(20-18-28)43(29-13-8-6-9-14-29)30-15-10-7-11-16-30/h6-11,13-24,26-27H,3-5,12,25H2,1-2H3 |
| InChIKey | HUMQAHQVRNYAGG-UHFFFAOYSA-N |
| XLogP | 11.97 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.95 |
| LogP ≤ 5 | 11.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|