C64H73N3O4S — CID 135297806
4-[5-[1,4-bis(2-ethylhexyl)-3-[4-[4-(N-(4-hexoxyphenyl)-4-methylanilino)phenyl]phenyl]-2,5-dioxopyrrolo[3,2-b]pyrrol-6-yl]thiophen-2-yl]benzaldehyde (PubChem CID 135297806) has the molecular formula C64H73N3O4S and a molecular weight of 980.37 g/mol. Its IUPAC name is 4-[5-[1,4-bis(2-ethylhexyl)-3-[4-[4-(N-(4-hexoxyphenyl)-4-methylanilino)phenyl]phenyl]-2,5-dioxopyrrolo[3,2-b]pyrrol-6-yl]thiophen-2-yl]benzaldehyde.
| Compound Name | 4-[5-[1,4-bis(2-ethylhexyl)-3-[4-[4-(N-(4-hexoxyphenyl)-4-methylanilino)phenyl]phenyl]-2,5-dioxopyrrolo[3,2-b]pyrrol-6-yl]thiophen-2-yl]benzaldehyde |
|---|---|
| PubChem CID | 135297806 |
| Molecular Formula | C64H73N3O4S |
| Molecular Weight | 980.37 g/mol |
| Exact Mass | 979.53 |
| IUPAC Name | 4-[5-[1,4-bis(2-ethylhexyl)-3-[4-[4-(N-(4-hexoxyphenyl)-4-methylanilino)phenyl]phenyl]-2,5-dioxopyrrolo[3,2-b]pyrrol-6-yl]thiophen-2-yl]benzaldehyde |
| SMILES | CCCCCCOc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(C4=C5C(=C(c6ccc(-c7ccc(C=O)cc7)s6)C(=O)N5CC(CC)CCCC)N(CC(CC)CCCC)C4=O)cc3)cc2)cc1 |
| InChI | InChI=1S/C64H73N3O4S/c1-7-12-15-16-41-71-56-37-35-55(36-38-56)67(53-31-19-45(6)20-32-53)54-33-29-50(30-34-54)49-25-27-52(28-26-49)59-61-62(66(63(59)69)43-47(11-5)18-14-9-3)60(64(70)65(61)42-46(10-4)17-13-8-2)58-40-39-57(72-58)51-23-21-48(44-68)22-24-51/h19-40,44,46-47H,7-18,41-43H2,1-6H3 |
| InChIKey | BVPOUKCPWHPQLI-UHFFFAOYSA-N |
| XLogP | 16.87 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 980.37 |
| LogP ≤ 5 | 16.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|