C40H48N2O2S4 — CID 53242294
2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 53242294) has the molecular formula C40H48N2O2S4 and a molecular weight of 717.10 g/mol. Its IUPAC name is 2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 53242294 |
| Molecular Formula | C40H48N2O2S4 |
| Molecular Weight | 717.10 g/mol |
| Exact Mass | 716.26 |
| IUPAC Name | 2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-methylthiophen-2-yl)thiophen-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ccc(-c4ccc(C)s4)s3)N(CC(CC)CCCC)C(=O)C2=C1c1ccc(-c2ccc(C)s2)s1 |
| InChI | InChI=1S/C40H48N2O2S4/c1-7-11-13-27(9-3)23-41-37(33-21-19-31(47-33)29-17-15-25(5)45-29)35-36(39(41)43)38(42(40(35)44)24-28(10-4)14-12-8-2)34-22-20-32(48-34)30-18-16-26(6)46-30/h15-22,27-28H,7-14,23-24H2,1-6H3 |
| InChIKey | OWRAEQYWMCTPGJ-UHFFFAOYSA-N |
| XLogP | 12.12 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 717.10 |
| LogP ≤ 5 | 12.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|