C32H41N3O2S2 — CID 146360758
5-[2,5-bis(2-ethylhexyl)-1-(5-methylthiophen-2-yl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophene-2-carbonitrile (PubChem CID 146360758) has the molecular formula C32H41N3O2S2 and a molecular weight of 563.83 g/mol. Its IUPAC name is 5-[2,5-bis(2-ethylhexyl)-1-(5-methylthiophen-2-yl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophene-2-carbonitrile.
| Compound Name | 5-[2,5-bis(2-ethylhexyl)-1-(5-methylthiophen-2-yl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophene-2-carbonitrile |
|---|---|
| PubChem CID | 146360758 |
| Molecular Formula | C32H41N3O2S2 |
| Molecular Weight | 563.83 g/mol |
| Exact Mass | 563.26 |
| IUPAC Name | 5-[2,5-bis(2-ethylhexyl)-1-(5-methylthiophen-2-yl)-3,6-dioxopyrrolo[3,4-c]pyrrol-4-yl]thiophene-2-carbonitrile |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ccc(C#N)s3)N(CC(CC)CCCC)C(=O)C2=C1c1ccc(C)s1 |
| InChI | InChI=1S/C32H41N3O2S2/c1-6-10-12-22(8-3)19-34-29(25-16-14-21(5)38-25)27-28(32(34)37)30(26-17-15-24(18-33)39-26)35(31(27)36)20-23(9-4)13-11-7-2/h14-17,22-23H,6-13,19-20H2,1-5H3 |
| InChIKey | RQZDFVUQLZHDMF-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.83 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|