C54H80N2O2S2 — CID 67952901
2,5-bis(2-hexyldecyl)-4-[5-(4-methylphenyl)thiophen-2-yl]-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 67952901) has the molecular formula C54H80N2O2S2 and a molecular weight of 853.38 g/mol. Its IUPAC name is 2,5-bis(2-hexyldecyl)-4-[5-(4-methylphenyl)thiophen-2-yl]-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis(2-hexyldecyl)-4-[5-(4-methylphenyl)thiophen-2-yl]-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 67952901 |
| Molecular Formula | C54H80N2O2S2 |
| Molecular Weight | 853.38 g/mol |
| Exact Mass | 852.57 |
| IUPAC Name | 2,5-bis(2-hexyldecyl)-4-[5-(4-methylphenyl)thiophen-2-yl]-1-(5-methylthiophen-2-yl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)C2=C(c3ccc(-c4ccc(C)cc4)s3)N(CC(CCCCCC)CCCCCCCC)C(=O)C2=C1c1ccc(C)s1 |
| InChI | InChI=1S/C54H80N2O2S2/c1-7-11-15-19-21-25-29-43(27-23-17-13-9-3)39-55-51(47-36-33-42(6)59-47)49-50(54(55)58)52(48-38-37-46(60-48)45-34-31-41(5)32-35-45)56(53(49)57)40-44(28-24-18-14-10-4)30-26-22-20-16-12-8-2/h31-38,43-44H,7-30,39-40H2,1-6H3 |
| InChIKey | YPDREVWKAQOTCP-UHFFFAOYSA-N |
| XLogP | 16.57 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.38 |
| LogP ≤ 5 | 16.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|