C30H40Br2N2OS2 — CID 130222179
3,6-bis(5-bromothiophen-2-yl)-2,5-bis(2-ethylhexyl)-1H-pyrrolo[3,4-c]pyrrol-4-one (PubChem CID 130222179) has the molecular formula C30H40Br2N2OS2 and a molecular weight of 668.61 g/mol. Its IUPAC name is 3,6-bis(5-bromothiophen-2-yl)-2,5-bis(2-ethylhexyl)-1H-pyrrolo[3,4-c]pyrrol-4-one.
| Compound Name | 3,6-bis(5-bromothiophen-2-yl)-2,5-bis(2-ethylhexyl)-1H-pyrrolo[3,4-c]pyrrol-4-one |
|---|---|
| PubChem CID | 130222179 |
| Molecular Formula | C30H40Br2N2OS2 |
| Molecular Weight | 668.61 g/mol |
| Exact Mass | 666.09 |
| IUPAC Name | 3,6-bis(5-bromothiophen-2-yl)-2,5-bis(2-ethylhexyl)-1H-pyrrolo[3,4-c]pyrrol-4-one |
| SMILES | CCCCC(CC)CN1CC2=C(c3ccc(Br)s3)N(CC(CC)CCCC)C(=O)C2=C1c1ccc(Br)s1 |
| InChI | InChI=1S/C30H40Br2N2OS2/c1-5-9-11-20(7-3)17-33-19-22-27(29(33)24-14-16-26(32)37-24)30(35)34(18-21(8-4)12-10-6-2)28(22)23-13-15-25(31)36-23/h13-16,20-21H,5-12,17-19H2,1-4H3 |
| InChIKey | YPOXOEDMSYGANJ-UHFFFAOYSA-N |
| XLogP | 10.05 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.61 |
| LogP ≤ 5 | 10.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|