C55H76N4O2S2 — CID 137413661
5-(2-ethylhexyl)-1,4-bis[5-[4-(heptan-3-ylamino)phenyl]thiophen-2-yl]-2-(2-methylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 137413661) has the molecular formula C55H76N4O2S2 and a molecular weight of 889.37 g/mol. Its IUPAC name is 5-(2-ethylhexyl)-1,4-bis[5-[4-(heptan-3-ylamino)phenyl]thiophen-2-yl]-2-(2-methylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 5-(2-ethylhexyl)-1,4-bis[5-[4-(heptan-3-ylamino)phenyl]thiophen-2-yl]-2-(2-methylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 137413661 |
| Molecular Formula | C55H76N4O2S2 |
| Molecular Weight | 889.37 g/mol |
| Exact Mass | 888.54 |
| IUPAC Name | 5-(2-ethylhexyl)-1,4-bis[5-[4-(heptan-3-ylamino)phenyl]thiophen-2-yl]-2-(2-methylhexyl)pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCC(C)CN1C(=O)C2=C(c3ccc(-c4ccc(NC(CC)CCCC)cc4)s3)N(CC(CC)CCCC)C(=O)C2=C1c1ccc(-c2ccc(NC(CC)CCCC)cc2)s1 |
| InChI | InChI=1S/C55H76N4O2S2/c1-9-16-20-38(8)36-58-52(48-34-32-46(62-48)40-24-28-44(29-25-40)56-42(14-6)22-18-11-3)50-51(54(58)60)53(59(55(50)61)37-39(13-5)21-17-10-2)49-35-33-47(63-49)41-26-30-45(31-27-41)57-43(15-7)23-19-12-4/h24-35,38-39,42-43,56-57H,9-23,36-37H2,1-8H3 |
| InChIKey | POOYMSRHJQVFRZ-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.37 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|