C39H48N2O3S2 — CID 155758085
4-[5-[2,5-bis(2-ethylhexyl)-3,6-dioxo-1-thiophen-2-ylpyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]-3,5-dimethylbenzaldehyde (PubChem CID 155758085) has the molecular formula C39H48N2O3S2 and a molecular weight of 656.96 g/mol. Its IUPAC name is 4-[5-[2,5-bis(2-ethylhexyl)-3,6-dioxo-1-thiophen-2-ylpyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]-3,5-dimethylbenzaldehyde.
| Compound Name | 4-[5-[2,5-bis(2-ethylhexyl)-3,6-dioxo-1-thiophen-2-ylpyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]-3,5-dimethylbenzaldehyde |
|---|---|
| PubChem CID | 155758085 |
| Molecular Formula | C39H48N2O3S2 |
| Molecular Weight | 656.96 g/mol |
| Exact Mass | 656.31 |
| IUPAC Name | 4-[5-[2,5-bis(2-ethylhexyl)-3,6-dioxo-1-thiophen-2-ylpyrrolo[3,4-c]pyrrol-4-yl]thiophen-2-yl]-3,5-dimethylbenzaldehyde |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ccc(-c4c(C)cc(C=O)cc4C)s3)N(CC(CC)CCCC)C(=O)C2=C1c1cccs1 |
| InChI | InChI=1S/C39H48N2O3S2/c1-7-11-14-27(9-3)22-40-36(31-16-13-19-45-31)34-35(39(40)44)37(41(38(34)43)23-28(10-4)15-12-8-2)32-18-17-30(46-32)33-25(5)20-29(24-42)21-26(33)6/h13,16-21,24,27-28H,7-12,14-15,22-23H2,1-6H3 |
| InChIKey | ZNLDCDNJWAMWFW-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.96 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|