C34H44N2O2S3 — CID 66993541
2,5-bis(2-ethylhexyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione;thiophene (PubChem CID 66993541) has the molecular formula C34H44N2O2S3 and a molecular weight of 608.94 g/mol. Its IUPAC name is 2,5-bis(2-ethylhexyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione;thiophene.
| Compound Name | 2,5-bis(2-ethylhexyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione;thiophene |
|---|---|
| PubChem CID | 66993541 |
| Molecular Formula | C34H44N2O2S3 |
| Molecular Weight | 608.94 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | 2,5-bis(2-ethylhexyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione;thiophene |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3cccs3)N(CC(CC)CCCC)C(=O)C2=C1c1cccs1.c1ccsc1 |
| InChI | InChI=1S/C30H40N2O2S2.C4H4S/c1-5-9-13-21(7-3)19-31-27(23-15-11-17-35-23)25-26(29(31)33)28(24-16-12-18-36-24)32(30(25)34)20-22(8-4)14-10-6-2;1-2-4-5-3-1/h11-12,15-18,21-22H,5-10,13-14,19-20H2,1-4H3;1-4H |
| InChIKey | KYFJLFAFJVVTEU-UHFFFAOYSA-N |
| XLogP | 9.80 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.94 |
| LogP ≤ 5 | 9.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|