C50H50N2O2S6 — CID 89495736
1,5-bis(2-ethylhexyl)-3,7-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[2,3-f]indole-2,6-dione (PubChem CID 89495736) has the molecular formula C50H50N2O2S6 and a molecular weight of 903.36 g/mol. Its IUPAC name is 1,5-bis(2-ethylhexyl)-3,7-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[2,3-f]indole-2,6-dione.
| Compound Name | 1,5-bis(2-ethylhexyl)-3,7-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[2,3-f]indole-2,6-dione |
|---|---|
| PubChem CID | 89495736 |
| Molecular Formula | C50H50N2O2S6 |
| Molecular Weight | 903.36 g/mol |
| Exact Mass | 902.22 |
| IUPAC Name | 1,5-bis(2-ethylhexyl)-3,7-bis[5-(5-thiophen-2-ylthiophen-2-yl)thiophen-2-yl]pyrrolo[2,3-f]indole-2,6-dione |
| SMILES | CCCCC(CC)CN1C(=O)C(c2ccc(-c3ccc(-c4cccs4)s3)s2)=c2cc3c(cc21)=C(c1ccc(-c2ccc(-c4cccs4)s2)s1)C(=O)N3CC(CC)CCCC |
| InChI | InChI=1S/C50H50N2O2S6/c1-5-9-13-31(7-3)29-51-35-27-34-36(28-33(35)47(49(51)53)45-23-21-43(59-45)41-19-17-39(57-41)37-15-11-25-55-37)52(30-32(8-4)14-10-6-2)50(54)48(34)46-24-22-44(60-46)42-20-18-40(58-42)38-16-12-26-56-38/h11-12,15-28,31-32H,5-10,13-14,29-30H2,1-4H3 |
| InChIKey | WZKNZAJVPNMGBY-UHFFFAOYSA-N |
| XLogP | 14.25 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 903.36 |
| LogP ≤ 5 | 14.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |