C44H46N4O2S6 — CID 67473040
2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)-1,3-thiazol-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 67473040) has the molecular formula C44H46N4O2S6 and a molecular weight of 855.28 g/mol. Its IUPAC name is 2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)-1,3-thiazol-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)-1,3-thiazol-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 67473040 |
| Molecular Formula | C44H46N4O2S6 |
| Molecular Weight | 855.28 g/mol |
| Exact Mass | 854.19 |
| IUPAC Name | 2,5-bis(2-ethylhexyl)-1,4-bis[5-(5-thiophen-2-ylthiophen-2-yl)-1,3-thiazol-2-yl]pyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCCCC(CC)CN1C(=O)C2=C(c3ncc(-c4ccc(-c5cccs5)s4)s3)N(CC(CC)CCCC)C(=O)C2=C1c1ncc(-c2ccc(-c3cccs3)s2)s1 |
| InChI | InChI=1S/C44H46N4O2S6/c1-5-9-13-27(7-3)25-47-39(41-45-23-35(55-41)33-19-17-31(53-33)29-15-11-21-51-29)37-38(43(47)49)40(48(44(37)50)26-28(8-4)14-10-6-2)42-46-24-36(56-42)34-20-18-32(54-34)30-16-12-22-52-30/h11-12,15-24,27-28H,5-10,13-14,25-26H2,1-4H3 |
| InChIKey | NHYMKFXWXZPAPA-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 855.28 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|