C50H76N2O2S2 — CID 170137405
1,5-bis(2-hexyldecyl)-6-hydroxy-3,7-dithiophen-2-yl-6H-pyrrolo[2,3-f]indol-2-one (PubChem CID 170137405) has the molecular formula C50H76N2O2S2 and a molecular weight of 801.30 g/mol. Its IUPAC name is 1,5-bis(2-hexyldecyl)-6-hydroxy-3,7-dithiophen-2-yl-6H-pyrrolo[2,3-f]indol-2-one.
| Compound Name | 1,5-bis(2-hexyldecyl)-6-hydroxy-3,7-dithiophen-2-yl-6H-pyrrolo[2,3-f]indol-2-one |
|---|---|
| PubChem CID | 170137405 |
| Molecular Formula | C50H76N2O2S2 |
| Molecular Weight | 801.30 g/mol |
| Exact Mass | 800.53 |
| IUPAC Name | 1,5-bis(2-hexyldecyl)-6-hydroxy-3,7-dithiophen-2-yl-6H-pyrrolo[2,3-f]indol-2-one |
| SMILES | CCCCCCCCC(CCCCCC)CN1C(=O)C(c2cccs2)=c2cc3c(cc21)=C(c1cccs1)C(O)N3CC(CCCCCC)CCCCCCCC |
| InChI | InChI=1S/C50H76N2O2S2/c1-5-9-13-17-19-23-29-39(27-21-15-11-7-3)37-51-43-35-42-44(36-41(43)47(49(51)53)45-31-25-33-55-45)52(50(54)48(42)46-32-26-34-56-46)38-40(28-22-16-12-8-4)30-24-20-18-14-10-6-2/h25-26,31-36,39-40,49,53H,5-24,27-30,37-38H2,1-4H3 |
| InChIKey | YPOBSJKVQSTAQZ-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 801.30 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|