C24H28N2O2S2 — CID 139245574
2,5-bis(2-methylbutyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione (PubChem CID 139245574) has the molecular formula C24H28N2O2S2 and a molecular weight of 440.63 g/mol. Its IUPAC name is 2,5-bis(2-methylbutyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione.
| Compound Name | 2,5-bis(2-methylbutyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione |
|---|---|
| PubChem CID | 139245574 |
| Molecular Formula | C24H28N2O2S2 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2,5-bis(2-methylbutyl)-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrole-3,6-dione |
| SMILES | CCC(C)CN1C(=O)C2=C(c3cccs3)N(CC(C)CC)C(=O)C2=C1c1cccs1 |
| InChI | InChI=1S/C24H28N2O2S2/c1-5-15(3)13-25-21(17-9-7-11-29-17)19-20(23(25)27)22(18-10-8-12-30-18)26(24(19)28)14-16(4)6-2/h7-12,15-16H,5-6,13-14H2,1-4H3 |
| InChIKey | PITKELWSILKTAR-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|