C18H12N2O6S2 — CID 132564005
2-[5-(carboxymethyl)-3,6-dioxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-2-yl]acetic acid (PubChem CID 132564005) has the molecular formula C18H12N2O6S2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 2-[5-(carboxymethyl)-3,6-dioxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-2-yl]acetic acid.
| Compound Name | 2-[5-(carboxymethyl)-3,6-dioxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-2-yl]acetic acid |
|---|---|
| PubChem CID | 132564005 |
| Molecular Formula | C18H12N2O6S2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.01 |
| IUPAC Name | 2-[5-(carboxymethyl)-3,6-dioxo-1,4-dithiophen-2-ylpyrrolo[3,4-c]pyrrol-2-yl]acetic acid |
| SMILES | O=C(O)CN1C(=O)C2=C(c3cccs3)N(CC(=O)O)C(=O)C2=C1c1cccs1 |
| InChI | InChI=1S/C18H12N2O6S2/c21-11(22)7-19-15(9-3-1-5-27-9)13-14(18(19)26)16(10-4-2-6-28-10)20(17(13)25)8-12(23)24/h1-6H,7-8H2,(H,21,22)(H,23,24) |
| InChIKey | VYLBKHOGZHUYAG-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_C(85)', 'substructure': 'N/A'} |
|---|