C9H7N3O4S — CID 82202307
1-(carboxymethyl)-5-thiophen-2-yltriazole-4-carboxylic acid (PubChem CID 82202307) has the molecular formula C9H7N3O4S and a molecular weight of 253.24 g/mol. Its IUPAC name is 1-(carboxymethyl)-5-thiophen-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-(carboxymethyl)-5-thiophen-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82202307 |
| Molecular Formula | C9H7N3O4S |
| Molecular Weight | 253.24 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 1-(carboxymethyl)-5-thiophen-2-yltriazole-4-carboxylic acid |
| SMILES | O=C(O)Cn1nnc(C(=O)O)c1-c1cccs1 |
| InChI | InChI=1S/C9H7N3O4S/c13-6(14)4-12-8(5-2-1-3-17-5)7(9(15)16)10-11-12/h1-3H,4H2,(H,13,14)(H,15,16) |
| InChIKey | OHVVEBQCIZFEDV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.24 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |