C9H9N3O2S — CID 82207138
1-ethyl-5-thiophen-2-yltriazole-4-carboxylic acid (PubChem CID 82207138) has the molecular formula C9H9N3O2S and a molecular weight of 223.26 g/mol. Its IUPAC name is 1-ethyl-5-thiophen-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-ethyl-5-thiophen-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82207138 |
| Molecular Formula | C9H9N3O2S |
| Molecular Weight | 223.26 g/mol |
| Exact Mass | 223.04 |
| IUPAC Name | 1-ethyl-5-thiophen-2-yltriazole-4-carboxylic acid |
| SMILES | CCn1nnc(C(=O)O)c1-c1cccs1 |
| InChI | InChI=1S/C9H9N3O2S/c1-2-12-8(6-4-3-5-15-6)7(9(13)14)10-11-12/h3-5H,2H2,1H3,(H,13,14) |
| InChIKey | CRDBWBAWLYMJLG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.26 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |