C13H16N4O3S — CID 94942399
1-[2-(diethylamino)-2-oxoethyl]-5-thiophen-2-yltriazole-4-carboxylic acid (PubChem CID 94942399) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-oxoethyl]-5-thiophen-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-[2-(diethylamino)-2-oxoethyl]-5-thiophen-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 94942399 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 1-[2-(diethylamino)-2-oxoethyl]-5-thiophen-2-yltriazole-4-carboxylic acid |
| SMILES | CCN(CC)C(=O)Cn1nnc(C(=O)O)c1-c1cccs1 |
| InChI | InChI=1S/C13H16N4O3S/c1-3-16(4-2)10(18)8-17-12(9-6-5-7-21-9)11(13(19)20)14-15-17/h5-7H,3-4,8H2,1-2H3,(H,19,20) |
| InChIKey | XSYORZORDUYNNR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |