C12H8BrN3O3S — CID 102645402
1-[(5-bromofuran-2-yl)methyl]-5-thiophen-2-yltriazole-4-carboxylic acid (PubChem CID 102645402) has the molecular formula C12H8BrN3O3S and a molecular weight of 354.19 g/mol. Its IUPAC name is 1-[(5-bromofuran-2-yl)methyl]-5-thiophen-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-[(5-bromofuran-2-yl)methyl]-5-thiophen-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645402 |
| Molecular Formula | C12H8BrN3O3S |
| Molecular Weight | 354.19 g/mol |
| Exact Mass | 352.95 |
| IUPAC Name | 1-[(5-bromofuran-2-yl)methyl]-5-thiophen-2-yltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2ccc(Br)o2)c1-c1cccs1 |
| InChI | InChI=1S/C12H8BrN3O3S/c13-9-4-3-7(19-9)6-16-11(8-2-1-5-20-8)10(12(17)18)14-15-16/h1-5H,6H2,(H,17,18) |
| InChIKey | AMERNPARSBZGJU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 81.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.19 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |