C13H15N3O3S — CID 102645256
1-(oxan-2-ylmethyl)-5-thiophen-2-yltriazole-4-carboxylic acid (PubChem CID 102645256) has the molecular formula C13H15N3O3S and a molecular weight of 293.35 g/mol. Its IUPAC name is 1-(oxan-2-ylmethyl)-5-thiophen-2-yltriazole-4-carboxylic acid.
| Compound Name | 1-(oxan-2-ylmethyl)-5-thiophen-2-yltriazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102645256 |
| Molecular Formula | C13H15N3O3S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 1-(oxan-2-ylmethyl)-5-thiophen-2-yltriazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(CC2CCCCO2)c1-c1cccs1 |
| InChI | InChI=1S/C13H15N3O3S/c17-13(18)11-12(10-5-3-7-20-10)16(15-14-11)8-9-4-1-2-6-19-9/h3,5,7,9H,1-2,4,6,8H2,(H,17,18) |
| InChIKey | PHLBFNJXUKKSOE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |