C10H16N4O3 — CID 103121895
5-(aminomethyl)-1-(oxan-2-ylmethyl)triazole-4-carboxylic acid (PubChem CID 103121895) has the molecular formula C10H16N4O3 and a molecular weight of 240.26 g/mol. Its IUPAC name is 5-(aminomethyl)-1-(oxan-2-ylmethyl)triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-(oxan-2-ylmethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103121895 |
| Molecular Formula | C10H16N4O3 |
| Molecular Weight | 240.26 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 5-(aminomethyl)-1-(oxan-2-ylmethyl)triazole-4-carboxylic acid |
| SMILES | NCc1c(C(=O)O)nnn1CC1CCCCO1 |
| InChI | InChI=1S/C10H16N4O3/c11-5-8-9(10(15)16)12-13-14(8)6-7-3-1-2-4-17-7/h7H,1-6,11H2,(H,15,16) |
| InChIKey | XZGHKPKGVKZYPG-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 103.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.26 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |