C7H12N4O2S — CID 103121827
5-(aminomethyl)-1-(2-methylsulfanylethyl)triazole-4-carboxylic acid (PubChem CID 103121827) has the molecular formula C7H12N4O2S and a molecular weight of 216.27 g/mol. Its IUPAC name is 5-(aminomethyl)-1-(2-methylsulfanylethyl)triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-(2-methylsulfanylethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103121827 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 5-(aminomethyl)-1-(2-methylsulfanylethyl)triazole-4-carboxylic acid |
| SMILES | CSCCn1nnc(C(=O)O)c1CN |
| InChI | InChI=1S/C7H12N4O2S/c1-14-3-2-11-5(4-8)6(7(12)13)9-10-11/h2-4,8H2,1H3,(H,12,13) |
| InChIKey | HDFMDWKMIYJRDZ-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |