C12H14N4O3 — CID 103121558
5-(aminomethyl)-1-(2-hydroxy-2-phenylethyl)triazole-4-carboxylic acid (PubChem CID 103121558) has the molecular formula C12H14N4O3 and a molecular weight of 262.27 g/mol. Its IUPAC name is 5-(aminomethyl)-1-(2-hydroxy-2-phenylethyl)triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-(2-hydroxy-2-phenylethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103121558 |
| Molecular Formula | C12H14N4O3 |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-(aminomethyl)-1-(2-hydroxy-2-phenylethyl)triazole-4-carboxylic acid |
| SMILES | NCc1c(C(=O)O)nnn1CC(O)c1ccccc1 |
| InChI | InChI=1S/C12H14N4O3/c13-6-9-11(12(18)19)14-15-16(9)7-10(17)8-4-2-1-3-5-8/h1-5,10,17H,6-7,13H2,(H,18,19) |
| InChIKey | UJVYCKYJIUAQSB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 114.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |