C13H18N6O2 — CID 103121957
5-(aminomethyl)-1-[(1-cyclopentylpyrazol-3-yl)methyl]triazole-4-carboxylic acid (PubChem CID 103121957) has the molecular formula C13H18N6O2 and a molecular weight of 290.33 g/mol. Its IUPAC name is 5-(aminomethyl)-1-[(1-cyclopentylpyrazol-3-yl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(aminomethyl)-1-[(1-cyclopentylpyrazol-3-yl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103121957 |
| Molecular Formula | C13H18N6O2 |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 5-(aminomethyl)-1-[(1-cyclopentylpyrazol-3-yl)methyl]triazole-4-carboxylic acid |
| SMILES | NCc1c(C(=O)O)nnn1Cc1ccn(C2CCCC2)n1 |
| InChI | InChI=1S/C13H18N6O2/c14-7-11-12(13(20)21)15-17-19(11)8-9-5-6-18(16-9)10-3-1-2-4-10/h5-6,10H,1-4,7-8,14H2,(H,20,21) |
| InChIKey | MPSWZOGKPDRJDO-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 111.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |