C11H14F3N3O3 — CID 102642707
1-[3-(oxolan-2-yl)propyl]-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 102642707) has the molecular formula C11H14F3N3O3 and a molecular weight of 293.25 g/mol. Its IUPAC name is 1-[3-(oxolan-2-yl)propyl]-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[3-(oxolan-2-yl)propyl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642707 |
| Molecular Formula | C11H14F3N3O3 |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-[3-(oxolan-2-yl)propyl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(CCCC2CCCO2)c1C(F)(F)F |
| InChI | InChI=1S/C11H14F3N3O3/c12-11(13,14)9-8(10(18)19)15-16-17(9)5-1-3-7-4-2-6-20-7/h7H,1-6H2,(H,18,19) |
| InChIKey | UKUNAZLXJYQARL-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |