C10H13F3N4O3 — CID 102642856
1-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 102642856) has the molecular formula C10H13F3N4O3 and a molecular weight of 294.23 g/mol. Its IUPAC name is 1-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642856 |
| Molecular Formula | C10H13F3N4O3 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-(2-morpholin-4-ylethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(CCN2CCOCC2)c1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O3/c11-10(12,13)8-7(9(18)19)14-15-17(8)2-1-16-3-5-20-6-4-16/h1-6H2,(H,18,19) |
| InChIKey | YBXFGMJTYVKMMV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |