C11H19N5O3 — CID 103119231
5-(2-aminoethyl)-1-(2-morpholin-4-ylethyl)triazole-4-carboxylic acid (PubChem CID 103119231) has the molecular formula C11H19N5O3 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-(2-aminoethyl)-1-(2-morpholin-4-ylethyl)triazole-4-carboxylic acid.
| Compound Name | 5-(2-aminoethyl)-1-(2-morpholin-4-ylethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 103119231 |
| Molecular Formula | C11H19N5O3 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 5-(2-aminoethyl)-1-(2-morpholin-4-ylethyl)triazole-4-carboxylic acid |
| SMILES | NCCc1c(C(=O)O)nnn1CCN1CCOCC1 |
| InChI | InChI=1S/C11H19N5O3/c12-2-1-9-10(11(17)18)13-14-16(9)4-3-15-5-7-19-8-6-15/h1-8,12H2,(H,17,18) |
| InChIKey | CNUWQBZKKZDIRK-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 106.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |