C7H7F3N4O3 — CID 102642731
1-(3-amino-3-oxopropyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 102642731) has the molecular formula C7H7F3N4O3 and a molecular weight of 252.15 g/mol. Its IUPAC name is 1-(3-amino-3-oxopropyl)-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(3-amino-3-oxopropyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642731 |
| Molecular Formula | C7H7F3N4O3 |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-(3-amino-3-oxopropyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | NC(=O)CCn1nnc(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C7H7F3N4O3/c8-7(9,10)5-4(6(16)17)12-13-14(5)2-1-3(11)15/h1-2H2,(H2,11,15)(H,16,17) |
| InChIKey | JIDVYLZLJMUVEW-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |