C7H6F3N3O2 — CID 82204447
1-prop-2-enyl-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 82204447) has the molecular formula C7H6F3N3O2 and a molecular weight of 221.14 g/mol. Its IUPAC name is 1-prop-2-enyl-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-prop-2-enyl-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82204447 |
| Molecular Formula | C7H6F3N3O2 |
| Molecular Weight | 221.14 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 1-prop-2-enyl-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | C=CCn1nnc(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C7H6F3N3O2/c1-2-3-13-5(7(8,9)10)4(6(14)15)11-12-13/h2H,1,3H2,(H,14,15) |
| InChIKey | MUTXYAMZZLDQPF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.14 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|