C10H11F3N4O3 — CID 102642926
1-[2-(cyclopropylmethylamino)-2-oxoethyl]-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 102642926) has the molecular formula C10H11F3N4O3 and a molecular weight of 292.22 g/mol. Its IUPAC name is 1-[2-(cyclopropylmethylamino)-2-oxoethyl]-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[2-(cyclopropylmethylamino)-2-oxoethyl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642926 |
| Molecular Formula | C10H11F3N4O3 |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 1-[2-(cyclopropylmethylamino)-2-oxoethyl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(Cn1nnc(C(=O)O)c1C(F)(F)F)NCC1CC1 |
| InChI | InChI=1S/C10H11F3N4O3/c11-10(12,13)8-7(9(19)20)15-16-17(8)4-6(18)14-3-5-1-2-5/h5H,1-4H2,(H,14,18)(H,19,20) |
| InChIKey | RHXBQFKUEFYOOI-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |