C12H10F3N3O3 — CID 102642733
1-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 102642733) has the molecular formula C12H10F3N3O3 and a molecular weight of 301.22 g/mol. Its IUPAC name is 1-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642733 |
| Molecular Formula | C12H10F3N3O3 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 1-[(4-methoxyphenyl)methyl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | COc1ccc(Cn2nnc(C(=O)O)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H10F3N3O3/c1-21-8-4-2-7(3-5-8)6-18-10(12(13,14)15)9(11(19)20)16-17-18/h2-5H,6H2,1H3,(H,19,20) |
| InChIKey | MUDHZUBJQWEFNQ-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |