C9H6F3N3O2S — CID 102642933
1-(thiophen-3-ylmethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 102642933) has the molecular formula C9H6F3N3O2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 1-(thiophen-3-ylmethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(thiophen-3-ylmethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642933 |
| Molecular Formula | C9H6F3N3O2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 1-(thiophen-3-ylmethyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1nnn(Cc2ccsc2)c1C(F)(F)F |
| InChI | InChI=1S/C9H6F3N3O2S/c10-9(11,12)7-6(8(16)17)13-14-15(7)3-5-1-2-18-4-5/h1-2,4H,3H2,(H,16,17) |
| InChIKey | WZFYWIFVAVOSOT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |