C9H12F3N3O3 — CID 114249970
1-(2-hydroxy-3-methylbutyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 114249970) has the molecular formula C9H12F3N3O3 and a molecular weight of 267.21 g/mol. Its IUPAC name is 1-(2-hydroxy-3-methylbutyl)-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(2-hydroxy-3-methylbutyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114249970 |
| Molecular Formula | C9H12F3N3O3 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | 1-(2-hydroxy-3-methylbutyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | CC(C)C(O)Cn1nnc(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C9H12F3N3O3/c1-4(2)5(16)3-15-7(9(10,11)12)6(8(17)18)13-14-15/h4-5,16H,3H2,1-2H3,(H,17,18) |
| InChIKey | QUTWFPBVNLOXNU-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |