C10H13F3N4O3 — CID 102642830
1-[1-oxo-1-(propylamino)propan-2-yl]-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 102642830) has the molecular formula C10H13F3N4O3 and a molecular weight of 294.23 g/mol. Its IUPAC name is 1-[1-oxo-1-(propylamino)propan-2-yl]-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-[1-oxo-1-(propylamino)propan-2-yl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 102642830 |
| Molecular Formula | C10H13F3N4O3 |
| Molecular Weight | 294.23 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 1-[1-oxo-1-(propylamino)propan-2-yl]-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | CCCNC(=O)C(C)n1nnc(C(=O)O)c1C(F)(F)F |
| InChI | InChI=1S/C10H13F3N4O3/c1-3-4-14-8(18)5(2)17-7(10(11,12)13)6(9(19)20)15-16-17/h5H,3-4H2,1-2H3,(H,14,18)(H,19,20) |
| InChIKey | LEJLYOSKMBKCAU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |