C19H18N4O4 — CID 18937617
3-[(4-methoxyphenyl)methyl]-5-[4-(methylamino)benzoyl]triazole-4-carboxylic acid (PubChem CID 18937617) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is 3-[(4-methoxyphenyl)methyl]-5-[4-(methylamino)benzoyl]triazole-4-carboxylic acid.
| Compound Name | 3-[(4-methoxyphenyl)methyl]-5-[4-(methylamino)benzoyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18937617 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | 3-[(4-methoxyphenyl)methyl]-5-[4-(methylamino)benzoyl]triazole-4-carboxylic acid |
| SMILES | CNc1ccc(C(=O)c2nnn(Cc3ccc(OC)cc3)c2C(=O)O)cc1 |
| InChI | InChI=1S/C19H18N4O4/c1-20-14-7-5-13(6-8-14)18(24)16-17(19(25)26)23(22-21-16)11-12-3-9-15(27-2)10-4-12/h3-10,20H,11H2,1-2H3,(H,25,26) |
| InChIKey | QOAVLZKIWUVNNS-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |