C20H20N4O4 — CID 18937579
5-(2-amino-4,5-dimethylbenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid (PubChem CID 18937579) has the molecular formula C20H20N4O4 and a molecular weight of 380.40 g/mol. Its IUPAC name is 5-(2-amino-4,5-dimethylbenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-(2-amino-4,5-dimethylbenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18937579 |
| Molecular Formula | C20H20N4O4 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | 5-(2-amino-4,5-dimethylbenzoyl)-3-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
| SMILES | COc1ccc(Cn2nnc(C(=O)c3cc(C)c(C)cc3N)c2C(=O)O)cc1 |
| InChI | InChI=1S/C20H20N4O4/c1-11-8-15(16(21)9-12(11)2)19(25)17-18(20(26)27)24(23-22-17)10-13-4-6-14(28-3)7-5-13/h4-9H,10,21H2,1-3H3,(H,26,27) |
| InChIKey | ZYZQHVXBTQZBDO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|