C20H18N4O8 — CID 18937663
5-[5-(methoxymethoxy)-2-nitrobenzoyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid (PubChem CID 18937663) has the molecular formula C20H18N4O8 and a molecular weight of 442.38 g/mol. Its IUPAC name is 5-[5-(methoxymethoxy)-2-nitrobenzoyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid.
| Compound Name | 5-[5-(methoxymethoxy)-2-nitrobenzoyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 18937663 |
| Molecular Formula | C20H18N4O8 |
| Molecular Weight | 442.38 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 5-[5-(methoxymethoxy)-2-nitrobenzoyl]-1-[(4-methoxyphenyl)methyl]triazole-4-carboxylic acid |
| SMILES | COCOc1ccc([N+](=O)[O-])c(C(=O)c2c(C(=O)O)nnn2Cc2ccc(OC)cc2)c1 |
| InChI | InChI=1S/C20H18N4O8/c1-30-11-32-14-7-8-16(24(28)29)15(9-14)19(25)18-17(20(26)27)21-22-23(18)10-12-3-5-13(31-2)6-4-12/h3-9H,10-11H2,1-2H3,(H,26,27) |
| InChIKey | FKVQDNBUHRPMQL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 155.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|